C18H25N5O2S — CID 174794698
2-[(5Z)-5-[[2-[3-[(dimethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde (PubChem CID 174794698) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2-[3-[(dimethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(5Z)-5-[[2-[3-[(dimethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174794698 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[(5Z)-5-[[2-[3-[(dimethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-yl]-2-oxoacetaldehyde |
| SMILES | CN(C)CC1CCCN(c2nccc(/C=C3\SCNC3C(=O)C=O)n2)C1 |
| InChI | InChI=1S/C18H25N5O2S/c1-22(2)9-13-4-3-7-23(10-13)18-19-6-5-14(21-18)8-16-17(15(25)11-24)20-12-26-16/h5-6,8,11,13,17,20H,3-4,7,9-10,12H2,1-2H3/b16-8- |
| InChIKey | JYZLNRYUTGJWTL-PXNMLYILSA-N |
| XLogP | 1.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|