C17H30O4 — CID 174795864
methyl 3,3-dimethyl-2-methylidenebutanoate;pentyl 2-methylprop-2-enoate (PubChem CID 174795864) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is methyl 3,3-dimethyl-2-methylidenebutanoate;pentyl 2-methylprop-2-enoate.
| Compound Name | methyl 3,3-dimethyl-2-methylidenebutanoate;pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174795864 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | methyl 3,3-dimethyl-2-methylidenebutanoate;pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C(=O)OC)C(C)(C)C.C=C(C)C(=O)OCCCCC |
| InChI | InChI=1S/C9H16O2.C8H14O2/c1-4-5-6-7-11-9(10)8(2)3;1-6(7(9)10-5)8(2,3)4/h2,4-7H2,1,3H3;1H2,2-5H3 |
| InChIKey | YLKMEDJTROPXFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|