About azane;pentanoyl 2-bromopentanoate
azane;pentanoyl 2-bromopentanoate (PubChem CID 174796677) has the molecular formula C10H23BrN2O3
and a molecular weight of 299.21 g/mol. Its IUPAC name is azane;pentanoyl 2-bromopentanoate.
Molecular Properties
| Compound Name | azane;pentanoyl 2-bromopentanoate |
| PubChem CID | 174796677 |
| Molecular Formula | C10H23BrN2O3 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | azane;pentanoyl 2-bromopentanoate |
| SMILES | CCCCC(=O)OC(=O)C(Br)CCC.N.N |
| InChI | InChI=1S/C10H17BrO3.2H3N/c1-3-5-7-9(12)14-10(13)8(11)6-4-2;;/h8H,3-7H2,1-2H3;2*1H3 |
| InChIKey | INWVOLYNERWQPS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;pentanoyl 2-bromopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;pentanoyl 2-bromopentanoate?
The IUPAC name of azane;pentanoyl 2-bromopentanoate (CID 174796677) is azane;pentanoyl 2-bromopentanoate.
What is the SMILES notation for azane;pentanoyl 2-bromopentanoate?
The canonical SMILES for azane;pentanoyl 2-bromopentanoate is CCCCC(=O)OC(=O)C(Br)CCC.N.N.
What is the InChIKey of azane;pentanoyl 2-bromopentanoate?
The InChIKey is INWVOLYNERWQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrO3.2H3N/c1-3-5-7-9(12)14-10(13)8(11)6-4-2;;/h8H,3-7H2,1-2H3;2*1H3.
What are the key properties of azane;pentanoyl 2-bromopentanoate?
azane;pentanoyl 2-bromopentanoate has a molecular weight of 299.21 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;pentanoyl 2-bromopentanoate is sourced from PubChem (CID 174796677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).