About trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane
trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane (PubChem CID 174796924) has the molecular formula C7H19F3O3S4
and a molecular weight of 336.49 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane.
Molecular Properties
| Compound Name | trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane |
| PubChem CID | 174796924 |
| Molecular Formula | C7H19F3O3S4 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane |
| SMILES | CS(C)(C)SS(C)(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C6H18S3.CHF3O3S/c1-8(2,3)7-9(4,5)6;2-1(3,4)8(5,6)7/h1-6H3;(H,5,6,7) |
| InChIKey | YZCNLNKCADEMFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane?
The IUPAC name of trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane (CID 174796924) is trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane.
What is the SMILES notation for trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane?
The canonical SMILES for trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane is CS(C)(C)SS(C)(C)C.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane?
The InChIKey is YZCNLNKCADEMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18S3.CHF3O3S/c1-8(2,3)7-9(4,5)6;2-1(3,4)8(5,6)7/h1-6H3;(H,5,6,7).
What are the key properties of trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane?
trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane has a molecular weight of 336.49 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonic acid;trimethyl-(trimethyl-λ4-sulfanyl)sulfanyl-λ4-sulfane is sourced from PubChem (CID 174796924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).