C17H12N2O3 — CID 174798016
bicyclo[2.2.0]hexa-1,3,5-triene;2-(2-nitrophenoxy)pyridine (PubChem CID 174798016) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-(2-nitrophenoxy)pyridine.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-(2-nitrophenoxy)pyridine |
|---|---|
| PubChem CID | 174798016 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-(2-nitrophenoxy)pyridine |
| SMILES | O=[N+]([O-])c1ccccc1Oc1ccccn1.c1cc2ccc1-2 |
| InChI | InChI=1S/C11H8N2O3.C6H4/c14-13(15)9-5-1-2-6-10(9)16-11-7-3-4-8-12-11;1-2-6-4-3-5(1)6/h1-8H;1-4H |
| InChIKey | YETVTTLXPVLEAP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|