C18H12ClF2N3O2 — CID 174799296
methyl 2-(2-chloro-4,6-dicyano-3,5-difluoroanilino)-3-phenylpropanoate (PubChem CID 174799296) has the molecular formula C18H12ClF2N3O2 and a molecular weight of 375.76 g/mol. Its IUPAC name is methyl 2-(2-chloro-4,6-dicyano-3,5-difluoroanilino)-3-phenylpropanoate.
| Compound Name | methyl 2-(2-chloro-4,6-dicyano-3,5-difluoroanilino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 174799296 |
| Molecular Formula | C18H12ClF2N3O2 |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | methyl 2-(2-chloro-4,6-dicyano-3,5-difluoroanilino)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)Nc1c(Cl)c(F)c(C#N)c(F)c1C#N |
| InChI | InChI=1S/C18H12ClF2N3O2/c1-26-18(25)13(7-10-5-3-2-4-6-10)24-17-12(9-23)15(20)11(8-22)16(21)14(17)19/h2-6,13,24H,7H2,1H3 |
| InChIKey | FAODUHPPNJRQKG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|