About 2-pentyl-1H-indole;piperazine-1-carboxamide
2-pentyl-1H-indole;piperazine-1-carboxamide (PubChem CID 174799325) has the molecular formula C18H28N4O
and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-pentyl-1H-indole;piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 2-pentyl-1H-indole;piperazine-1-carboxamide |
| PubChem CID | 174799325 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 2-pentyl-1H-indole;piperazine-1-carboxamide |
| SMILES | CCCCCc1cc2ccccc2[nH]1.NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C13H17N.C5H11N3O/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)14-12;6-5(9)8-3-1-7-2-4-8/h5-7,9-10,14H,2-4,8H2,1H3;7H,1-4H2,(H2,6,9) |
| InChIKey | XFROAPBDCYDNGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-1H-indole;piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-1H-indole;piperazine-1-carboxamide?
The IUPAC name of 2-pentyl-1H-indole;piperazine-1-carboxamide (CID 174799325) is 2-pentyl-1H-indole;piperazine-1-carboxamide.
What is the SMILES notation for 2-pentyl-1H-indole;piperazine-1-carboxamide?
The canonical SMILES for 2-pentyl-1H-indole;piperazine-1-carboxamide is CCCCCc1cc2ccccc2[nH]1.NC(=O)N1CCNCC1.
What is the InChIKey of 2-pentyl-1H-indole;piperazine-1-carboxamide?
The InChIKey is XFROAPBDCYDNGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.C5H11N3O/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)14-12;6-5(9)8-3-1-7-2-4-8/h5-7,9-10,14H,2-4,8H2,1H3;7H,1-4H2,(H2,6,9).
What are the key properties of 2-pentyl-1H-indole;piperazine-1-carboxamide?
2-pentyl-1H-indole;piperazine-1-carboxamide has a molecular weight of 316.45 g/mol, XLogP of 2.87, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-1H-indole;piperazine-1-carboxamide is sourced from PubChem (CID 174799325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).