About formamide;2-pentyl-1H-indole;piperazine
formamide;2-pentyl-1H-indole;piperazine (PubChem CID 174799337) has the molecular formula C18H30N4O
and a molecular weight of 318.46 g/mol. Its IUPAC name is formamide;2-pentyl-1H-indole;piperazine.
Molecular Properties
| Compound Name | formamide;2-pentyl-1H-indole;piperazine |
| PubChem CID | 174799337 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | formamide;2-pentyl-1H-indole;piperazine |
| SMILES | C1CNCCN1.CCCCCc1cc2ccccc2[nH]1.NC=O |
| InChI | InChI=1S/C13H17N.C4H10N2.CH3NO/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)14-12;1-2-6-4-3-5-1;2-1-3/h5-7,9-10,14H,2-4,8H2,1H3;5-6H,1-4H2;1H,(H2,2,3) |
| InChIKey | QZEALKXIRMPJJM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formamide;2-pentyl-1H-indole;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;2-pentyl-1H-indole;piperazine?
The IUPAC name of formamide;2-pentyl-1H-indole;piperazine (CID 174799337) is formamide;2-pentyl-1H-indole;piperazine.
What is the SMILES notation for formamide;2-pentyl-1H-indole;piperazine?
The canonical SMILES for formamide;2-pentyl-1H-indole;piperazine is C1CNCCN1.CCCCCc1cc2ccccc2[nH]1.NC=O.
What is the InChIKey of formamide;2-pentyl-1H-indole;piperazine?
The InChIKey is QZEALKXIRMPJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.C4H10N2.CH3NO/c1-2-3-4-8-12-10-11-7-5-6-9-13(11)14-12;1-2-6-4-3-5-1;2-1-3/h5-7,9-10,14H,2-4,8H2,1H3;5-6H,1-4H2;1H,(H2,2,3).
What are the key properties of formamide;2-pentyl-1H-indole;piperazine?
formamide;2-pentyl-1H-indole;piperazine has a molecular weight of 318.46 g/mol, XLogP of 2.18, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;2-pentyl-1H-indole;piperazine is sourced from PubChem (CID 174799337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).