C19H40N2O4 — CID 174804809
4-ethyl-1-pentylpiperidine;methyl hydrogen carbonate;4-methylmorpholine (PubChem CID 174804809) has the molecular formula C19H40N2O4 and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-ethyl-1-pentylpiperidine;methyl hydrogen carbonate;4-methylmorpholine.
| Compound Name | 4-ethyl-1-pentylpiperidine;methyl hydrogen carbonate;4-methylmorpholine |
|---|---|
| PubChem CID | 174804809 |
| Molecular Formula | C19H40N2O4 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 4-ethyl-1-pentylpiperidine;methyl hydrogen carbonate;4-methylmorpholine |
| SMILES | CCCCCN1CCC(CC)CC1.CN1CCOCC1.COC(=O)O |
| InChI | InChI=1S/C12H25N.C5H11NO.C2H4O3/c1-3-5-6-9-13-10-7-12(4-2)8-11-13;1-6-2-4-7-5-3-6;1-5-2(3)4/h12H,3-11H2,1-2H3;2-5H2,1H3;1H3,(H,3,4) |
| InChIKey | SECIDBUQRQHQRU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|