C17H23ClN2O5 — CID 174805562
[[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-phenylmethyl] carbonochloridate (PubChem CID 174805562) has the molecular formula C17H23ClN2O5 and a molecular weight of 370.83 g/mol. Its IUPAC name is [[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-phenylmethyl] carbonochloridate.
| Compound Name | [[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-phenylmethyl] carbonochloridate |
|---|---|
| PubChem CID | 174805562 |
| Molecular Formula | C17H23ClN2O5 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-phenylmethyl] carbonochloridate |
| SMILES | CC(C)(C)OC(=O)NC1CN(C(OC(=O)Cl)c2ccccc2)CC1O |
| InChI | InChI=1S/C17H23ClN2O5/c1-17(2,3)25-16(23)19-12-9-20(10-13(12)21)14(24-15(18)22)11-7-5-4-6-8-11/h4-8,12-14,21H,9-10H2,1-3H3,(H,19,23) |
| InChIKey | CNSYINVLPWWEEH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|