C25H33N3O4S — CID 174805648
(1S,2R,6R,8S,11S,12S,15S,16S)-5,15-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-ene-4-carbonitrile;6-methyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 174805648) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is (1S,2R,6R,8S,11S,12S,15S,16S)-5,15-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-ene-4-carbonitrile;6-methyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | (1S,2R,6R,8S,11S,12S,15S,16S)-5,15-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-ene-4-carbonitrile;6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 174805648 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (1S,2R,6R,8S,11S,12S,15S,16S)-5,15-dihydroxy-2,16-dimethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-ene-4-carbonitrile;6-methyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@]45O[C@@H]4C(O)=C(C#N)C[C@]35C)[C@@H]1CC[C@@H]2O.Cc1cc(=O)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C20H27NO3.C5H6N2OS/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2;1-3-2-4(8)7-5(9)6-3/h12-15,17,22-23H,3-9H2,1-2H3;2H,1H3,(H2,6,7,8,9)/t12-,13-,14-,15-,17+,18-,19+,20+;/m0./s1 |
| InChIKey | HZRHVCVWVSNLOW-YKMWGNFISA-N |
| XLogP | 4.21 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|