C16H26N2O4 — CID 174805775
benzene;[2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate (PubChem CID 174805775) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is benzene;[2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate.
| Compound Name | benzene;[2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate |
|---|---|
| PubChem CID | 174805775 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | benzene;[2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate |
| SMILES | CCC(C)C(C)(COC(N)=O)COC(N)=O.c1ccccc1 |
| InChI | InChI=1S/C10H20N2O4.C6H6/c1-4-7(2)10(3,5-15-8(11)13)6-16-9(12)14;1-2-4-6-5-3-1/h7H,4-6H2,1-3H3,(H2,11,13)(H2,12,14);1-6H |
| InChIKey | VPQNWEBSSSLKKI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |