C18H34Br2O10 — CID 174806183
1,6-dibromohexane-2,3,4,5-tetrol;2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxymethyl]oxirane (PubChem CID 174806183) has the molecular formula C18H34Br2O10 and a molecular weight of 570.27 g/mol. Its IUPAC name is 1,6-dibromohexane-2,3,4,5-tetrol;2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxymethyl]oxirane.
| Compound Name | 1,6-dibromohexane-2,3,4,5-tetrol;2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 174806183 |
| Molecular Formula | C18H34Br2O10 |
| Molecular Weight | 570.27 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | 1,6-dibromohexane-2,3,4,5-tetrol;2-[2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]ethoxymethyl]oxirane |
| SMILES | C(COCCOCC1CO1)OCCOCC1CO1.OC(CBr)C(O)C(O)C(O)CBr |
| InChI | InChI=1S/C12H22O6.C6H12Br2O4/c1(13-3-5-15-7-11-9-17-11)2-14-4-6-16-8-12-10-18-12;7-1-3(9)5(11)6(12)4(10)2-8/h11-12H,1-10H2;3-6,9-12H,1-2H2 |
| InChIKey | UYCUNZCITOUJHL-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|