About carbamic acid;2-trimethoxysilylethanol
carbamic acid;2-trimethoxysilylethanol (PubChem CID 174807168) has the molecular formula C6H17NO6Si
and a molecular weight of 227.29 g/mol. Its IUPAC name is carbamic acid;2-trimethoxysilylethanol.
Molecular Properties
| Compound Name | carbamic acid;2-trimethoxysilylethanol |
| PubChem CID | 174807168 |
| Molecular Formula | C6H17NO6Si |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | carbamic acid;2-trimethoxysilylethanol |
| SMILES | CO[Si](CCO)(OC)OC.NC(=O)O |
| InChI | InChI=1S/C5H14O4Si.CH3NO2/c1-7-10(8-2,9-3)5-4-6;2-1(3)4/h6H,4-5H2,1-3H3;2H2,(H,3,4) |
| InChIKey | GLLLYTHHDHJVJZ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;2-trimethoxysilylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;2-trimethoxysilylethanol?
The IUPAC name of carbamic acid;2-trimethoxysilylethanol (CID 174807168) is carbamic acid;2-trimethoxysilylethanol.
What is the SMILES notation for carbamic acid;2-trimethoxysilylethanol?
The canonical SMILES for carbamic acid;2-trimethoxysilylethanol is CO[Si](CCO)(OC)OC.NC(=O)O.
What is the InChIKey of carbamic acid;2-trimethoxysilylethanol?
The InChIKey is GLLLYTHHDHJVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O4Si.CH3NO2/c1-7-10(8-2,9-3)5-4-6;2-1(3)4/h6H,4-5H2,1-3H3;2H2,(H,3,4).
What are the key properties of carbamic acid;2-trimethoxysilylethanol?
carbamic acid;2-trimethoxysilylethanol has a molecular weight of 227.29 g/mol, XLogP of -0.52, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;2-trimethoxysilylethanol is sourced from PubChem (CID 174807168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).