About chloro-bis(2-methylpropyl)alumane;hexane
chloro-bis(2-methylpropyl)alumane;hexane (PubChem CID 174808933) has the molecular formula C14H32AlCl
and a molecular weight of 262.84 g/mol. Its IUPAC name is chloro-bis(2-methylpropyl)alumane;hexane.
Molecular Properties
| Compound Name | chloro-bis(2-methylpropyl)alumane;hexane |
| PubChem CID | 174808933 |
| Molecular Formula | C14H32AlCl |
| Molecular Weight | 262.84 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | chloro-bis(2-methylpropyl)alumane;hexane |
| SMILES | CC(C)C[Al](Cl)CC(C)C.CCCCCC |
| InChI | InChI=1S/C6H14.2C4H9.Al.ClH/c1-3-5-6-4-2;2*1-4(2)3;;/h3-6H2,1-2H3;2*4H,1H2,2-3H3;;1H/q;;;+1;/p-1 |
| InChIKey | CJIRBTBJXGCSJW-UHFFFAOYSA-M |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.84 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze chloro-bis(2-methylpropyl)alumane;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-bis(2-methylpropyl)alumane;hexane?
The IUPAC name of chloro-bis(2-methylpropyl)alumane;hexane (CID 174808933) is chloro-bis(2-methylpropyl)alumane;hexane.
What is the SMILES notation for chloro-bis(2-methylpropyl)alumane;hexane?
The canonical SMILES for chloro-bis(2-methylpropyl)alumane;hexane is CC(C)C[Al](Cl)CC(C)C.CCCCCC.
What is the InChIKey of chloro-bis(2-methylpropyl)alumane;hexane?
The InChIKey is CJIRBTBJXGCSJW-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14.2C4H9.Al.ClH/c1-3-5-6-4-2;2*1-4(2)3;;/h3-6H2,1-2H3;2*4H,1H2,2-3H3;;1H/q;;;+1;/p-1.
What are the key properties of chloro-bis(2-methylpropyl)alumane;hexane?
chloro-bis(2-methylpropyl)alumane;hexane has a molecular weight of 262.84 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-bis(2-methylpropyl)alumane;hexane is sourced from PubChem (CID 174808933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).