C13H14O2S — CID 174808941
5-methyl-3-(2-phenylethyl)thiolane-2,4-dione (PubChem CID 174808941) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-methyl-3-(2-phenylethyl)thiolane-2,4-dione.
| Compound Name | 5-methyl-3-(2-phenylethyl)thiolane-2,4-dione |
|---|---|
| PubChem CID | 174808941 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5-methyl-3-(2-phenylethyl)thiolane-2,4-dione |
| SMILES | CC1SC(=O)C(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C13H14O2S/c1-9-12(14)11(13(15)16-9)8-7-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | OZDZVYNXVLGVAT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|