C27H52O3PS+ — CID 174810947
2,3-dibutylbenzenesulfonic acid;tributyl(methyl)phosphanium (PubChem CID 174810947) has the molecular formula C27H52O3PS+ and a molecular weight of 487.75 g/mol. Its IUPAC name is 2,3-dibutylbenzenesulfonic acid;tributyl(methyl)phosphanium.
| Compound Name | 2,3-dibutylbenzenesulfonic acid;tributyl(methyl)phosphanium |
|---|---|
| PubChem CID | 174810947 |
| Molecular Formula | C27H52O3PS+ |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 487.34 |
| IUPAC Name | 2,3-dibutylbenzenesulfonic acid;tributyl(methyl)phosphanium |
| SMILES | CCCC[P+](C)(CCCC)CCCC.CCCCc1cccc(S(=O)(=O)O)c1CCCC |
| InChI | InChI=1S/C14H22O3S.C13H30P/c1-3-5-8-12-9-7-11-14(18(15,16)17)13(12)10-6-4-2;1-5-8-11-14(4,12-9-6-2)13-10-7-3/h7,9,11H,3-6,8,10H2,1-2H3,(H,15,16,17);5-13H2,1-4H3/q;+1 |
| InChIKey | FFGZVCDMIJVOTF-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|