C24H26N2O7 — CID 174811995
5-[4-(methylcarbamoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydroisoquinoline-1,1-dicarboxylic acid (PubChem CID 174811995) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 5-[4-(methylcarbamoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydroisoquinoline-1,1-dicarboxylic acid.
| Compound Name | 5-[4-(methylcarbamoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydroisoquinoline-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 174811995 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 5-[4-(methylcarbamoyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydroisoquinoline-1,1-dicarboxylic acid |
| SMILES | CNC(=O)c1ccc(-c2cccc3c2CCN(C(=O)OC(C)(C)C)C3(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C24H26N2O7/c1-23(2,3)33-22(32)26-13-12-17-16(14-8-10-15(11-9-14)19(27)25-4)6-5-7-18(17)24(26,20(28)29)21(30)31/h5-11H,12-13H2,1-4H3,(H,25,27)(H,28,29)(H,30,31) |
| InChIKey | XIOSLQKSTHLCFK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|