C22H13N2O5S2+ — CID 174813003
3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydron;isothiocyanato thiocyanate (PubChem CID 174813003) has the molecular formula C22H13N2O5S2+ and a molecular weight of 449.49 g/mol. Its IUPAC name is 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydron;isothiocyanato thiocyanate.
| Compound Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydron;isothiocyanato thiocyanate |
|---|---|
| PubChem CID | 174813003 |
| Molecular Formula | C22H13N2O5S2+ |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydron;isothiocyanato thiocyanate |
| SMILES | N#CSN=C=S.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21.[H+] |
| InChI | InChI=1S/C20H12O5.C2N2S2/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;3-1-6-4-2-5/h1-10,21-22H;/p+1 |
| InChIKey | BNCDDPDLVDOXFB-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|