C11H18Cl2O7 — CID 174813334
chloro 2-chloro-3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]prop-2-enoate (PubChem CID 174813334) has the molecular formula C11H18Cl2O7 and a molecular weight of 333.16 g/mol. Its IUPAC name is chloro 2-chloro-3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]prop-2-enoate.
| Compound Name | chloro 2-chloro-3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]prop-2-enoate |
|---|---|
| PubChem CID | 174813334 |
| Molecular Formula | C11H18Cl2O7 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | chloro 2-chloro-3-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]prop-2-enoate |
| SMILES | O=C(OCl)C(Cl)=COCCOCCOCCOCCO |
| InChI | InChI=1S/C11H18Cl2O7/c12-10(11(15)20-13)9-19-8-7-18-6-5-17-4-3-16-2-1-14/h9,14H,1-8H2 |
| InChIKey | YOSKHFYCNIHXOV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|