C8H21N7O2 — CID 174815065
1-amino-1-[3-[3-[amino(carbamoyl)amino]propylamino]propyl]urea (PubChem CID 174815065) has the molecular formula C8H21N7O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-amino-1-[3-[3-[amino(carbamoyl)amino]propylamino]propyl]urea.
| Compound Name | 1-amino-1-[3-[3-[amino(carbamoyl)amino]propylamino]propyl]urea |
|---|---|
| PubChem CID | 174815065 |
| Molecular Formula | C8H21N7O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 1-amino-1-[3-[3-[amino(carbamoyl)amino]propylamino]propyl]urea |
| SMILES | NC(=O)N(N)CCCNCCCN(N)C(N)=O |
| InChI | InChI=1S/C8H21N7O2/c9-7(16)14(11)5-1-3-13-4-2-6-15(12)8(10)17/h13H,1-6,11-12H2,(H2,9,16)(H2,10,17) |
| InChIKey | QGPDNGQIHJKPDZ-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 156.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|