C12H28N6O3 — CID 174619807
1-amino-1-[10-[amino(carbamoyl)amino]-5-hydroxydecyl]urea (PubChem CID 174619807) has the molecular formula C12H28N6O3 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-amino-1-[10-[amino(carbamoyl)amino]-5-hydroxydecyl]urea.
| Compound Name | 1-amino-1-[10-[amino(carbamoyl)amino]-5-hydroxydecyl]urea |
|---|---|
| PubChem CID | 174619807 |
| Molecular Formula | C12H28N6O3 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-amino-1-[10-[amino(carbamoyl)amino]-5-hydroxydecyl]urea |
| SMILES | NC(=O)N(N)CCCCCC(O)CCCCN(N)C(N)=O |
| InChI | InChI=1S/C12H28N6O3/c13-11(20)17(15)8-4-1-2-6-10(19)7-3-5-9-18(16)12(14)21/h10,19H,1-9,15-16H2,(H2,13,20)(H2,14,21) |
| InChIKey | SDXAXSWBZRBUIT-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|