C8H20Cl2N6O4 — CID 174417262
5-[amino(carbamoyl)amino]-2-[[amino(carbamoyl)amino]methyl]pentanoic acid;dihydrochloride (PubChem CID 174417262) has the molecular formula C8H20Cl2N6O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is 5-[amino(carbamoyl)amino]-2-[[amino(carbamoyl)amino]methyl]pentanoic acid;dihydrochloride.
| Compound Name | 5-[amino(carbamoyl)amino]-2-[[amino(carbamoyl)amino]methyl]pentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 174417262 |
| Molecular Formula | C8H20Cl2N6O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-[amino(carbamoyl)amino]-2-[[amino(carbamoyl)amino]methyl]pentanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)N(N)CCCC(CN(N)C(N)=O)C(=O)O |
| InChI | InChI=1S/C8H18N6O4.2ClH/c9-7(17)13(11)3-1-2-5(6(15)16)4-14(12)8(10)18;;/h5H,1-4,11-12H2,(H2,9,17)(H2,10,18)(H,15,16);2*1H |
| InChIKey | IFPVSTCBGXSNMZ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 182.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|