C8H16F2N6O4 — CID 174452815
2,5-bis[amino(carbamoyl)amino]-2-(difluoromethyl)pentanoic acid (PubChem CID 174452815) has the molecular formula C8H16F2N6O4 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2,5-bis[amino(carbamoyl)amino]-2-(difluoromethyl)pentanoic acid.
| Compound Name | 2,5-bis[amino(carbamoyl)amino]-2-(difluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 174452815 |
| Molecular Formula | C8H16F2N6O4 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,5-bis[amino(carbamoyl)amino]-2-(difluoromethyl)pentanoic acid |
| SMILES | NC(=O)N(N)CCCC(C(=O)O)(C(F)F)N(N)C(N)=O |
| InChI | InChI=1S/C8H16F2N6O4/c9-4(10)8(5(17)18,16(14)7(12)20)2-1-3-15(13)6(11)19/h4H,1-3,13-14H2,(H2,11,19)(H2,12,20)(H,17,18) |
| InChIKey | UEQGNMZWGYYCSE-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 182.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|