C12H29N7O2 — CID 174894318
1-amino-1-[8-[amino(carbamoyl)amino]-4-(2-aminoethyl)octyl]urea (PubChem CID 174894318) has the molecular formula C12H29N7O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-amino-1-[8-[amino(carbamoyl)amino]-4-(2-aminoethyl)octyl]urea.
| Compound Name | 1-amino-1-[8-[amino(carbamoyl)amino]-4-(2-aminoethyl)octyl]urea |
|---|---|
| PubChem CID | 174894318 |
| Molecular Formula | C12H29N7O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 1-amino-1-[8-[amino(carbamoyl)amino]-4-(2-aminoethyl)octyl]urea |
| SMILES | NCCC(CCCCN(N)C(N)=O)CCCN(N)C(N)=O |
| InChI | InChI=1S/C12H29N7O2/c13-7-6-10(5-3-9-19(17)12(15)21)4-1-2-8-18(16)11(14)20/h10H,1-9,13,16-17H2,(H2,14,20)(H2,15,21) |
| InChIKey | WYHRPXBGLRXNDR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|