About decan-5-ol;1,1-diaminourea
decan-5-ol;1,1-diaminourea (PubChem CID 174750930) has the molecular formula C11H28N4O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is decan-5-ol;1,1-diaminourea.
Molecular Properties
| Compound Name | decan-5-ol;1,1-diaminourea |
| PubChem CID | 174750930 |
| Molecular Formula | C11H28N4O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.22 |
| IUPAC Name | decan-5-ol;1,1-diaminourea |
| SMILES | CCCCCC(O)CCCC.NC(=O)N(N)N |
| InChI | InChI=1S/C10H22O.CH6N4O/c1-3-5-7-9-10(11)8-6-4-2;2-1(6)5(3)4/h10-11H,3-9H2,1-2H3;3-4H2,(H2,2,6) |
| InChIKey | BKDYAYRLFFQXBL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze decan-5-ol;1,1-diaminourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-5-ol;1,1-diaminourea?
The IUPAC name of decan-5-ol;1,1-diaminourea (CID 174750930) is decan-5-ol;1,1-diaminourea.
What is the SMILES notation for decan-5-ol;1,1-diaminourea?
The canonical SMILES for decan-5-ol;1,1-diaminourea is CCCCCC(O)CCCC.NC(=O)N(N)N.
What is the InChIKey of decan-5-ol;1,1-diaminourea?
The InChIKey is BKDYAYRLFFQXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.CH6N4O/c1-3-5-7-9-10(11)8-6-4-2;2-1(6)5(3)4/h10-11H,3-9H2,1-2H3;3-4H2,(H2,2,6).
What are the key properties of decan-5-ol;1,1-diaminourea?
decan-5-ol;1,1-diaminourea has a molecular weight of 248.37 g/mol, XLogP of 1.23, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decan-5-ol;1,1-diaminourea is sourced from PubChem (CID 174750930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).