C12H23N3O2 — CID 174815612
(6-isocyanato-3,3,5,5-tetramethylhexyl)urea (PubChem CID 174815612) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is (6-isocyanato-3,3,5,5-tetramethylhexyl)urea.
| Compound Name | (6-isocyanato-3,3,5,5-tetramethylhexyl)urea |
|---|---|
| PubChem CID | 174815612 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (6-isocyanato-3,3,5,5-tetramethylhexyl)urea |
| SMILES | CC(C)(CCNC(N)=O)CC(C)(C)CN=C=O |
| InChI | InChI=1S/C12H23N3O2/c1-11(2,5-6-15-10(13)17)7-12(3,4)8-14-9-16/h5-8H2,1-4H3,(H3,13,15,17) |
| InChIKey | LZVITMKCJZIZGX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|