C16H28ClN3O2S — CID 174816760
2-chloroethenylbenzene;methylsulfonylmethane;1,1,2,3,3-pentamethylguanidine (PubChem CID 174816760) has the molecular formula C16H28ClN3O2S and a molecular weight of 361.94 g/mol. Its IUPAC name is 2-chloroethenylbenzene;methylsulfonylmethane;1,1,2,3,3-pentamethylguanidine.
| Compound Name | 2-chloroethenylbenzene;methylsulfonylmethane;1,1,2,3,3-pentamethylguanidine |
|---|---|
| PubChem CID | 174816760 |
| Molecular Formula | C16H28ClN3O2S |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-chloroethenylbenzene;methylsulfonylmethane;1,1,2,3,3-pentamethylguanidine |
| SMILES | CN=C(N(C)C)N(C)C.CS(C)(=O)=O.ClC=Cc1ccccc1 |
| InChI | InChI=1S/C8H7Cl.C6H15N3.C2H6O2S/c9-7-6-8-4-2-1-3-5-8;1-7-6(8(2)3)9(4)5;1-5(2,3)4/h1-7H;1-5H3;1-2H3 |
| InChIKey | BACKWSPLRAZLSG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|