About silyl acetate;N-(silylmethylidene)hydroxylamine
silyl acetate;N-(silylmethylidene)hydroxylamine (PubChem CID 174817840) has the molecular formula C3H11NO3Si2
and a molecular weight of 165.30 g/mol. Its IUPAC name is silyl acetate;N-(silylmethylidene)hydroxylamine.
Molecular Properties
| Compound Name | silyl acetate;N-(silylmethylidene)hydroxylamine |
| PubChem CID | 174817840 |
| Molecular Formula | C3H11NO3Si2 |
| Molecular Weight | 165.30 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | silyl acetate;N-(silylmethylidene)hydroxylamine |
| SMILES | CC(=O)O[SiH3].ON=C[SiH3] |
| InChI | InChI=1S/C2H6O2Si.CH5NOSi/c1-2(3)4-5;3-2-1-4/h1,5H3;1,3H,4H3 |
| InChIKey | NIUXKSKKLYKDEV-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.30 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silyl acetate;N-(silylmethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl acetate;N-(silylmethylidene)hydroxylamine?
The IUPAC name of silyl acetate;N-(silylmethylidene)hydroxylamine (CID 174817840) is silyl acetate;N-(silylmethylidene)hydroxylamine.
What is the SMILES notation for silyl acetate;N-(silylmethylidene)hydroxylamine?
The canonical SMILES for silyl acetate;N-(silylmethylidene)hydroxylamine is CC(=O)O[SiH3].ON=C[SiH3].
What is the InChIKey of silyl acetate;N-(silylmethylidene)hydroxylamine?
The InChIKey is NIUXKSKKLYKDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O2Si.CH5NOSi/c1-2(3)4-5;3-2-1-4/h1,5H3;1,3H,4H3.
What are the key properties of silyl acetate;N-(silylmethylidene)hydroxylamine?
silyl acetate;N-(silylmethylidene)hydroxylamine has a molecular weight of 165.30 g/mol, XLogP of -2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silyl acetate;N-(silylmethylidene)hydroxylamine is sourced from PubChem (CID 174817840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).