About butane-2,3-dione;silyloxysilane
butane-2,3-dione;silyloxysilane (PubChem CID 173372168) has the molecular formula C4H12O3Si2
and a molecular weight of 164.31 g/mol. Its IUPAC name is butane-2,3-dione;silyloxysilane.
Molecular Properties
| Compound Name | butane-2,3-dione;silyloxysilane |
| PubChem CID | 173372168 |
| Molecular Formula | C4H12O3Si2 |
| Molecular Weight | 164.31 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | butane-2,3-dione;silyloxysilane |
| SMILES | CC(=O)C(C)=O.[SiH3]O[SiH3] |
| InChI | InChI=1S/C4H6O2.H6OSi2/c1-3(5)4(2)6;2-1-3/h1-2H3;2-3H3 |
| InChIKey | JSMGPGMBTNLSIF-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.31 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butane-2,3-dione;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-dione;silyloxysilane?
The IUPAC name of butane-2,3-dione;silyloxysilane (CID 173372168) is butane-2,3-dione;silyloxysilane.
What is the SMILES notation for butane-2,3-dione;silyloxysilane?
The canonical SMILES for butane-2,3-dione;silyloxysilane is CC(=O)C(C)=O.[SiH3]O[SiH3].
What is the InChIKey of butane-2,3-dione;silyloxysilane?
The InChIKey is JSMGPGMBTNLSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.H6OSi2/c1-3(5)4(2)6;2-1-3/h1-2H3;2-3H3.
What are the key properties of butane-2,3-dione;silyloxysilane?
butane-2,3-dione;silyloxysilane has a molecular weight of 164.31 g/mol, XLogP of -2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-dione;silyloxysilane is sourced from PubChem (CID 173372168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).