About 1-silyloxysilylethanone
1-silyloxysilylethanone (PubChem CID 154037854) has the molecular formula C2H8O2Si2
and a molecular weight of 120.26 g/mol. Its IUPAC name is 1-silyloxysilylethanone.
Molecular Properties
| Compound Name | 1-silyloxysilylethanone |
| PubChem CID | 154037854 |
| Molecular Formula | C2H8O2Si2 |
| Molecular Weight | 120.26 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | 1-silyloxysilylethanone |
| SMILES | CC(=O)[SiH2]O[SiH3] |
| InChI | InChI=1S/C2H8O2Si2/c1-2(3)6-4-5/h6H2,1,5H3 |
| InChIKey | FDKPEACNPCSJSL-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.26 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-silyloxysilylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-silyloxysilylethanone?
The IUPAC name of 1-silyloxysilylethanone (CID 154037854) is 1-silyloxysilylethanone.
What is the SMILES notation for 1-silyloxysilylethanone?
The canonical SMILES for 1-silyloxysilylethanone is CC(=O)[SiH2]O[SiH3].
What is the InChIKey of 1-silyloxysilylethanone?
The InChIKey is FDKPEACNPCSJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8O2Si2/c1-2(3)6-4-5/h6H2,1,5H3.
What are the key properties of 1-silyloxysilylethanone?
1-silyloxysilylethanone has a molecular weight of 120.26 g/mol, XLogP of -2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-silyloxysilylethanone is sourced from PubChem (CID 154037854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).