About N,N-dimethanidylacetamide;tungsten(2+)
N,N-dimethanidylacetamide;tungsten(2+) (PubChem CID 59567944) has the molecular formula C4H7NOW
and a molecular weight of 268.95 g/mol. Its IUPAC name is N,N-dimethanidylacetamide;tungsten(2+).
Molecular Properties
| Compound Name | N,N-dimethanidylacetamide;tungsten(2+) |
| PubChem CID | 59567944 |
| Molecular Formula | C4H7NOW |
| Molecular Weight | 268.95 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N,N-dimethanidylacetamide;tungsten(2+) |
| SMILES | [CH2-]N([CH2-])C(C)=O.[W+2] |
| InChI | InChI=1S/C4H7NO.W/c1-4(6)5(2)3;/h2-3H2,1H3;/q-2;+2 |
| InChIKey | OJRIMGAGBNOORN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.95 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethanidylacetamide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethanidylacetamide;tungsten(2+)?
The IUPAC name of N,N-dimethanidylacetamide;tungsten(2+) (CID 59567944) is N,N-dimethanidylacetamide;tungsten(2+).
What is the SMILES notation for N,N-dimethanidylacetamide;tungsten(2+)?
The canonical SMILES for N,N-dimethanidylacetamide;tungsten(2+) is [CH2-]N([CH2-])C(C)=O.[W+2].
What is the InChIKey of N,N-dimethanidylacetamide;tungsten(2+)?
The InChIKey is OJRIMGAGBNOORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.W/c1-4(6)5(2)3;/h2-3H2,1H3;/q-2;+2.
What are the key properties of N,N-dimethanidylacetamide;tungsten(2+)?
N,N-dimethanidylacetamide;tungsten(2+) has a molecular weight of 268.95 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethanidylacetamide;tungsten(2+) is sourced from PubChem (CID 59567944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).