About N,N-diacetylacetamide;trihydrochloride
N,N-diacetylacetamide;trihydrochloride (PubChem CID 173022405) has the molecular formula C6H12Cl3NO3
and a molecular weight of 252.52 g/mol. Its IUPAC name is N,N-diacetylacetamide;trihydrochloride.
Molecular Properties
| Compound Name | N,N-diacetylacetamide;trihydrochloride |
| PubChem CID | 173022405 |
| Molecular Formula | C6H12Cl3NO3 |
| Molecular Weight | 252.52 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | N,N-diacetylacetamide;trihydrochloride |
| SMILES | CC(=O)N(C(C)=O)C(C)=O.Cl.Cl.Cl |
| InChI | InChI=1S/C6H9NO3.3ClH/c1-4(8)7(5(2)9)6(3)10;;;/h1-3H3;3*1H |
| InChIKey | PFMVJCRXXHPIAX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diacetylacetamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diacetylacetamide;trihydrochloride?
The IUPAC name of N,N-diacetylacetamide;trihydrochloride (CID 173022405) is N,N-diacetylacetamide;trihydrochloride.
What is the SMILES notation for N,N-diacetylacetamide;trihydrochloride?
The canonical SMILES for N,N-diacetylacetamide;trihydrochloride is CC(=O)N(C(C)=O)C(C)=O.Cl.Cl.Cl.
What is the InChIKey of N,N-diacetylacetamide;trihydrochloride?
The InChIKey is PFMVJCRXXHPIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.3ClH/c1-4(8)7(5(2)9)6(3)10;;;/h1-3H3;3*1H.
What are the key properties of N,N-diacetylacetamide;trihydrochloride?
N,N-diacetylacetamide;trihydrochloride has a molecular weight of 252.52 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diacetylacetamide;trihydrochloride is sourced from PubChem (CID 173022405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).