About (diacetylamino)-λ2-stannane
(diacetylamino)-λ2-stannane (PubChem CID 174584376) has the molecular formula C4H7NO2Sn
and a molecular weight of 219.82 g/mol. Its IUPAC name is (diacetylamino)-λ2-stannane.
Molecular Properties
| Compound Name | (diacetylamino)-λ2-stannane |
| PubChem CID | 174584376 |
| Molecular Formula | C4H7NO2Sn |
| Molecular Weight | 219.82 g/mol |
| Exact Mass | 220.95 |
| IUPAC Name | (diacetylamino)-λ2-stannane |
| SMILES | CC(=O)N([SnH])C(C)=O |
| InChI | InChI=1S/C4H7NO2.Sn.H/c1-3(6)5-4(2)7;;/h1-2H3,(H,5,6,7);;/q;+1;/p-1 |
| InChIKey | WWAKJRLWZFMXIM-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.82 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (diacetylamino)-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diacetylamino)-λ2-stannane?
The IUPAC name of (diacetylamino)-λ2-stannane (CID 174584376) is (diacetylamino)-λ2-stannane.
What is the SMILES notation for (diacetylamino)-λ2-stannane?
The canonical SMILES for (diacetylamino)-λ2-stannane is CC(=O)N([SnH])C(C)=O.
What is the InChIKey of (diacetylamino)-λ2-stannane?
The InChIKey is WWAKJRLWZFMXIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7NO2.Sn.H/c1-3(6)5-4(2)7;;/h1-2H3,(H,5,6,7);;/q;+1;/p-1.
What are the key properties of (diacetylamino)-λ2-stannane?
(diacetylamino)-λ2-stannane has a molecular weight of 219.82 g/mol, XLogP of -0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (diacetylamino)-λ2-stannane is sourced from PubChem (CID 174584376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).