About N-acetyl-N-hydroxyacetamide;formaldehyde
N-acetyl-N-hydroxyacetamide;formaldehyde (PubChem CID 144940058) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is N-acetyl-N-hydroxyacetamide;formaldehyde.
Molecular Properties
| Compound Name | N-acetyl-N-hydroxyacetamide;formaldehyde |
| PubChem CID | 144940058 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | N-acetyl-N-hydroxyacetamide;formaldehyde |
| SMILES | C=O.CC(=O)N(O)C(C)=O |
| InChI | InChI=1S/C4H7NO3.CH2O/c1-3(6)5(8)4(2)7;1-2/h8H,1-2H3;1H2 |
| InChIKey | VSCZGMYPLJZUKQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-N-hydroxyacetamide;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-hydroxyacetamide;formaldehyde?
The IUPAC name of N-acetyl-N-hydroxyacetamide;formaldehyde (CID 144940058) is N-acetyl-N-hydroxyacetamide;formaldehyde.
What is the SMILES notation for N-acetyl-N-hydroxyacetamide;formaldehyde?
The canonical SMILES for N-acetyl-N-hydroxyacetamide;formaldehyde is C=O.CC(=O)N(O)C(C)=O.
What is the InChIKey of N-acetyl-N-hydroxyacetamide;formaldehyde?
The InChIKey is VSCZGMYPLJZUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3.CH2O/c1-3(6)5(8)4(2)7;1-2/h8H,1-2H3;1H2.
What are the key properties of N-acetyl-N-hydroxyacetamide;formaldehyde?
N-acetyl-N-hydroxyacetamide;formaldehyde has a molecular weight of 147.13 g/mol, XLogP of -0.41, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-hydroxyacetamide;formaldehyde is sourced from PubChem (CID 144940058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).