About N',N'-diacetylacetohydrazide
N',N'-diacetylacetohydrazide (PubChem CID 13230474) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is N',N'-diacetylacetohydrazide.
Molecular Properties
| Compound Name | N',N'-diacetylacetohydrazide |
| PubChem CID | 13230474 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N',N'-diacetylacetohydrazide |
| SMILES | CC(=O)NN(C(C)=O)C(C)=O |
| InChI | InChI=1S/C6H10N2O3/c1-4(9)7-8(5(2)10)6(3)11/h1-3H3,(H,7,9) |
| InChIKey | VWBVKMSHZUUXKH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diacetylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diacetylacetohydrazide?
The IUPAC name of N',N'-diacetylacetohydrazide (CID 13230474) is N',N'-diacetylacetohydrazide.
What is the SMILES notation for N',N'-diacetylacetohydrazide?
The canonical SMILES for N',N'-diacetylacetohydrazide is CC(=O)NN(C(C)=O)C(C)=O.
What is the InChIKey of N',N'-diacetylacetohydrazide?
The InChIKey is VWBVKMSHZUUXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-4(9)7-8(5(2)10)6(3)11/h1-3H3,(H,7,9).
What are the key properties of N',N'-diacetylacetohydrazide?
N',N'-diacetylacetohydrazide has a molecular weight of 158.16 g/mol, XLogP of -0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diacetylacetohydrazide is sourced from PubChem (CID 13230474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).