C10H23N3O5S — CID 175118779
acetamido(acetyl)sulfamic acid;N,N-diethylethanamine (PubChem CID 175118779) has the molecular formula C10H23N3O5S and a molecular weight of 297.38 g/mol. Its IUPAC name is acetamido(acetyl)sulfamic acid;N,N-diethylethanamine.
| Compound Name | acetamido(acetyl)sulfamic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 175118779 |
| Molecular Formula | C10H23N3O5S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | acetamido(acetyl)sulfamic acid;N,N-diethylethanamine |
| SMILES | CC(=O)NN(C(C)=O)S(=O)(=O)O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H8N2O5S/c1-4-7(5-2)6-3;1-3(7)5-6(4(2)8)12(9,10)11/h4-6H2,1-3H3;1-2H3,(H,5,7)(H,9,10,11) |
| InChIKey | FDUAJORYSKQKOW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|