C8H17NOW — CID 157427240
N,N-dimethanidyl-2-methylpropanamide;ethane;tungsten(2+) (PubChem CID 157427240) has the molecular formula C8H17NOW and a molecular weight of 327.07 g/mol. Its IUPAC name is N,N-dimethanidyl-2-methylpropanamide;ethane;tungsten(2+).
| Compound Name | N,N-dimethanidyl-2-methylpropanamide;ethane;tungsten(2+) |
|---|---|
| PubChem CID | 157427240 |
| Molecular Formula | C8H17NOW |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N,N-dimethanidyl-2-methylpropanamide;ethane;tungsten(2+) |
| SMILES | CC.[CH2-]N([CH2-])C(=O)C(C)C.[W+2] |
| InChI | InChI=1S/C6H11NO.C2H6.W/c1-5(2)6(8)7(3)4;1-2;/h5H,3-4H2,1-2H3;1-2H3;/q-2;;+2 |
| InChIKey | BQCHSAFIRCGBLE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|