About 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate
2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate (PubChem CID 174797718) has the molecular formula C12H26O7Si2
and a molecular weight of 338.51 g/mol. Its IUPAC name is 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate.
Molecular Properties
| Compound Name | 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate |
| PubChem CID | 174797718 |
| Molecular Formula | C12H26O7Si2 |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate |
| SMILES | CC(=O)OC=COC(C)=O.CC(=O)O[SiH3].CC(C)(C)O[SiH3] |
| InChI | InChI=1S/C6H8O4.C4H12OSi.C2H6O2Si/c1-5(7)9-3-4-10-6(2)8;1-4(2,3)5-6;1-2(3)4-5/h3-4H,1-2H3;1-3,6H3;1,5H3 |
| InChIKey | IFECTZOPECKBBS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate?
The IUPAC name of 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate (CID 174797718) is 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate.
What is the SMILES notation for 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate?
The canonical SMILES for 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate is CC(=O)OC=COC(C)=O.CC(=O)O[SiH3].CC(C)(C)O[SiH3].
What is the InChIKey of 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate?
The InChIKey is IFECTZOPECKBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4.C4H12OSi.C2H6O2Si/c1-5(7)9-3-4-10-6(2)8;1-4(2,3)5-6;1-2(3)4-5/h3-4H,1-2H3;1-3,6H3;1,5H3.
What are the key properties of 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate?
2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate has a molecular weight of 338.51 g/mol, XLogP of -0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethenyl acetate;(2-methylpropan-2-yl)oxysilane;silyl acetate is sourced from PubChem (CID 174797718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).