C16H14O2 — CID 174818329
15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxirane (PubChem CID 174818329) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxirane.
| Compound Name | 15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxirane |
|---|---|
| PubChem CID | 174818329 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 15-oxatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaene;oxirane |
| SMILES | C1CO1.c1ccc2c(c1)C1OC2c2ccccc21 |
| InChI | InChI=1S/C14H10O.C2H4O/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14(10)15-13;1-2-3-1/h1-8,13-14H;1-2H2 |
| InChIKey | FZBXINZBLUEWBM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|