C20H10F8O — CID 10884261
(12R,15S)-2,2,3,3,8,8,9,9-octafluoro-19-oxapentacyclo[8.6.2.24,7.112,15.011,16]henicosa-1(16),4,6,10,13,17,20-heptaene (PubChem CID 10884261) has the molecular formula C20H10F8O and a molecular weight of 418.28 g/mol. Its IUPAC name is (12R,15S)-2,2,3,3,8,8,9,9-octafluoro-19-oxapentacyclo[8.6.2.24,7.112,15.011,16]henicosa-1(16),4,6,10,13,17,20-heptaene.
| Compound Name | (12R,15S)-2,2,3,3,8,8,9,9-octafluoro-19-oxapentacyclo[8.6.2.24,7.112,15.011,16]henicosa-1(16),4,6,10,13,17,20-heptaene |
|---|---|
| PubChem CID | 10884261 |
| Molecular Formula | C20H10F8O |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | (12R,15S)-2,2,3,3,8,8,9,9-octafluoro-19-oxapentacyclo[8.6.2.24,7.112,15.011,16]henicosa-1(16),4,6,10,13,17,20-heptaene |
| SMILES | FC1(F)c2ccc(cc2)C(F)(F)C(F)(F)c2ccc(c3c2[C@H]2C=C[C@@H]3O2)C1(F)F |
| InChI | InChI=1S/C20H10F8O/c21-17(22)9-1-2-10(4-3-9)18(23,24)20(27,28)12-6-5-11(19(17,25)26)15-13-7-8-14(29-13)16(12)15/h1-8,13-14H/t13-,14+ |
| InChIKey | IBQTVJRMFIZTSV-OKILXGFUSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|