C25H23N3O3S — CID 17481913
2-[benzenesulfonyl(benzyl)amino]-N-(isoquinolin-1-ylmethyl)acetamide (PubChem CID 17481913) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-(isoquinolin-1-ylmethyl)acetamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-(isoquinolin-1-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17481913 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-(isoquinolin-1-ylmethyl)acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccccc1)NCc1nccc2ccccc12 |
| InChI | InChI=1S/C25H23N3O3S/c29-25(27-17-24-23-14-8-7-11-21(23)15-16-26-24)19-28(18-20-9-3-1-4-10-20)32(30,31)22-12-5-2-6-13-22/h1-16H,17-19H2,(H,27,29) |
| InChIKey | SLWKFNJNYZPJLX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |