About 2-(azidomethyl)-4-nitrophenol;toluene
2-(azidomethyl)-4-nitrophenol;toluene (PubChem CID 174820001) has the molecular formula C14H14N4O3
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-(azidomethyl)-4-nitrophenol;toluene.
Molecular Properties
| Compound Name | 2-(azidomethyl)-4-nitrophenol;toluene |
| PubChem CID | 174820001 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(azidomethyl)-4-nitrophenol;toluene |
| SMILES | Cc1ccccc1.[N-]=[N+]=NCc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6N4O3.C7H8/c8-10-9-4-5-3-6(11(13)14)1-2-7(5)12;1-7-5-3-2-4-6-7/h1-3,12H,4H2;2-6H,1H3 |
| InChIKey | SAJLSWVHCHVXHX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-4-nitrophenol;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-4-nitrophenol;toluene?
The IUPAC name of 2-(azidomethyl)-4-nitrophenol;toluene (CID 174820001) is 2-(azidomethyl)-4-nitrophenol;toluene.
What is the SMILES notation for 2-(azidomethyl)-4-nitrophenol;toluene?
The canonical SMILES for 2-(azidomethyl)-4-nitrophenol;toluene is Cc1ccccc1.[N-]=[N+]=NCc1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of 2-(azidomethyl)-4-nitrophenol;toluene?
The InChIKey is SAJLSWVHCHVXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O3.C7H8/c8-10-9-4-5-3-6(11(13)14)1-2-7(5)12;1-7-5-3-2-4-6-7/h1-3,12H,4H2;2-6H,1H3.
What are the key properties of 2-(azidomethyl)-4-nitrophenol;toluene?
2-(azidomethyl)-4-nitrophenol;toluene has a molecular weight of 286.29 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-4-nitrophenol;toluene is sourced from PubChem (CID 174820001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).