About ethyl(dimethyl)azanium tetrafluoroborate
ethyl(dimethyl)azanium tetrafluoroborate (PubChem CID 174821443) has the molecular formula C4H12BF4N
and a molecular weight of 160.95 g/mol. Its IUPAC name is ethyl(dimethyl)azanium tetrafluoroborate.
Molecular Properties
| Compound Name | ethyl(dimethyl)azanium tetrafluoroborate |
| PubChem CID | 174821443 |
| Molecular Formula | C4H12BF4N |
| Molecular Weight | 160.95 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | ethyl(dimethyl)azanium tetrafluoroborate |
| SMILES | CC[NH+](C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C4H11N.BF4/c1-4-5(2)3;2-1(3,4)5/h4H2,1-3H3;/q;-1/p+1 |
| InChIKey | ZHVHDDPMMXECDF-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.95 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)azanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)azanium tetrafluoroborate?
The IUPAC name of ethyl(dimethyl)azanium tetrafluoroborate (CID 174821443) is ethyl(dimethyl)azanium tetrafluoroborate.
What is the SMILES notation for ethyl(dimethyl)azanium tetrafluoroborate?
The canonical SMILES for ethyl(dimethyl)azanium tetrafluoroborate is CC[NH+](C)C.F[B-](F)(F)F.
What is the InChIKey of ethyl(dimethyl)azanium tetrafluoroborate?
The InChIKey is ZHVHDDPMMXECDF-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H11N.BF4/c1-4-5(2)3;2-1(3,4)5/h4H2,1-3H3;/q;-1/p+1.
What are the key properties of ethyl(dimethyl)azanium tetrafluoroborate?
ethyl(dimethyl)azanium tetrafluoroborate has a molecular weight of 160.95 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)azanium tetrafluoroborate is sourced from PubChem (CID 174821443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).