C4H13BF6NS- — CID 175400657
N,N-diethylthiohydroxylamine;tetrafluoroborate;dihydrofluoride (PubChem CID 175400657) has the molecular formula C4H13BF6NS- and a molecular weight of 232.02 g/mol. Its IUPAC name is N,N-diethylthiohydroxylamine;tetrafluoroborate;dihydrofluoride.
| Compound Name | N,N-diethylthiohydroxylamine;tetrafluoroborate;dihydrofluoride |
|---|---|
| PubChem CID | 175400657 |
| Molecular Formula | C4H13BF6NS- |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N,N-diethylthiohydroxylamine;tetrafluoroborate;dihydrofluoride |
| SMILES | CCN(S)CC.F.F.F[B-](F)(F)F |
| InChI | InChI=1S/C4H11NS.BF4.2FH/c1-3-5(6)4-2;2-1(3,4)5;;/h6H,3-4H2,1-2H3;;2*1H/q;-1;; |
| InChIKey | AWMFZPBLLWOCTQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|