About 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine
10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine (PubChem CID 174822140) has the molecular formula C23H48N4
and a molecular weight of 380.67 g/mol. Its IUPAC name is 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine.
Molecular Properties
| Compound Name | 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine |
| PubChem CID | 174822140 |
| Molecular Formula | C23H48N4 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.39 |
| IUPAC Name | 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine |
| SMILES | NCCCCCCCCCCC1CCCCC1C1CCCCC1.[H]N=C(N)N |
| InChI | InChI=1S/C22H43N.CH5N3/c23-19-13-6-4-2-1-3-5-8-14-21-17-11-12-18-22(21)20-15-9-7-10-16-20;2-1(3)4/h20-22H,1-19,23H2;(H5,2,3,4) |
| InChIKey | GRHXZPUWRNHLQR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine?
The IUPAC name of 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine (CID 174822140) is 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine.
What is the SMILES notation for 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine?
The canonical SMILES for 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine is NCCCCCCCCCCC1CCCCC1C1CCCCC1.[H]N=C(N)N.
What is the InChIKey of 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine?
The InChIKey is GRHXZPUWRNHLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43N.CH5N3/c23-19-13-6-4-2-1-3-5-8-14-21-17-11-12-18-22(21)20-15-9-7-10-16-20;2-1(3)4/h20-22H,1-19,23H2;(H5,2,3,4).
What are the key properties of 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine?
10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine has a molecular weight of 380.67 g/mol, XLogP of 5.68, 11 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-cyclohexylcyclohexyl)decan-1-amine;guanidine is sourced from PubChem (CID 174822140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).