About pyridine;2-(trichloromethyl)-1H-pyrrole
pyridine;2-(trichloromethyl)-1H-pyrrole (PubChem CID 174822327) has the molecular formula C10H9Cl3N2
and a molecular weight of 263.56 g/mol. Its IUPAC name is pyridine;2-(trichloromethyl)-1H-pyrrole.
Molecular Properties
| Compound Name | pyridine;2-(trichloromethyl)-1H-pyrrole |
| PubChem CID | 174822327 |
| Molecular Formula | C10H9Cl3N2 |
| Molecular Weight | 263.56 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | pyridine;2-(trichloromethyl)-1H-pyrrole |
| SMILES | ClC(Cl)(Cl)c1ccc[nH]1.c1ccncc1 |
| InChI | InChI=1S/C5H4Cl3N.C5H5N/c6-5(7,8)4-2-1-3-9-4;1-2-4-6-5-3-1/h1-3,9H;1-5H |
| InChIKey | TVXLRIWBMNLSHX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze pyridine;2-(trichloromethyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;2-(trichloromethyl)-1H-pyrrole?
The IUPAC name of pyridine;2-(trichloromethyl)-1H-pyrrole (CID 174822327) is pyridine;2-(trichloromethyl)-1H-pyrrole.
What is the SMILES notation for pyridine;2-(trichloromethyl)-1H-pyrrole?
The canonical SMILES for pyridine;2-(trichloromethyl)-1H-pyrrole is ClC(Cl)(Cl)c1ccc[nH]1.c1ccncc1.
What is the InChIKey of pyridine;2-(trichloromethyl)-1H-pyrrole?
The InChIKey is TVXLRIWBMNLSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl3N.C5H5N/c6-5(7,8)4-2-1-3-9-4;1-2-4-6-5-3-1/h1-3,9H;1-5H.
What are the key properties of pyridine;2-(trichloromethyl)-1H-pyrrole?
pyridine;2-(trichloromethyl)-1H-pyrrole has a molecular weight of 263.56 g/mol, XLogP of 3.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;2-(trichloromethyl)-1H-pyrrole is sourced from PubChem (CID 174822327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).