About 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate
3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate (PubChem CID 174824022) has the molecular formula C14H26O6
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate.
Molecular Properties
| Compound Name | 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate |
| PubChem CID | 174824022 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate |
| SMILES | CCOC(CC)(OC(=O)CC)C(=O)OCCC(C)OC |
| InChI | InChI=1S/C14H26O6/c1-6-12(15)20-14(7-2,19-8-3)13(16)18-10-9-11(4)17-5/h11H,6-10H2,1-5H3 |
| InChIKey | SCCRFBHPROARMP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate?
The IUPAC name of 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate (CID 174824022) is 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate.
What is the SMILES notation for 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate?
The canonical SMILES for 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate is CCOC(CC)(OC(=O)CC)C(=O)OCCC(C)OC.
What is the InChIKey of 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate?
The InChIKey is SCCRFBHPROARMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O6/c1-6-12(15)20-14(7-2,19-8-3)13(16)18-10-9-11(4)17-5/h11H,6-10H2,1-5H3.
What are the key properties of 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate?
3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate has a molecular weight of 290.36 g/mol, XLogP of 2.05, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutyl 2-ethoxy-2-propanoyloxybutanoate is sourced from PubChem (CID 174824022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).