C15H21NO5 — CID 174827067
4-(3-amino-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid (PubChem CID 174827067) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 4-(3-amino-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid.
| Compound Name | 4-(3-amino-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
|---|---|
| PubChem CID | 174827067 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-(3-amino-2-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)C(CCc1cccc(N)c1O)C(=O)O |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(20)10(13(18)19)8-7-9-5-4-6-11(16)12(9)17/h4-6,10,17H,7-8,16H2,1-3H3,(H,18,19) |
| InChIKey | CWQOSNWRNFTCHQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|