C10H21NO3 — CID 174828129
3,4-dihydroxy-1-(pentylamino)pentan-2-one (PubChem CID 174828129) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 3,4-dihydroxy-1-(pentylamino)pentan-2-one.
| Compound Name | 3,4-dihydroxy-1-(pentylamino)pentan-2-one |
|---|---|
| PubChem CID | 174828129 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3,4-dihydroxy-1-(pentylamino)pentan-2-one |
| SMILES | CCCCCNCC(=O)C(O)C(C)O |
| InChI | InChI=1S/C10H21NO3/c1-3-4-5-6-11-7-9(13)10(14)8(2)12/h8,10-12,14H,3-7H2,1-2H3 |
| InChIKey | QHYFTBUHYZCLPZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|